C32H30N2O12 — CID 162813892
3-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-4,5,9-trihydroxy-8-(methylamino)-2-oxa-6-azabicyclo[3.3.1]nonane-1-carboxylic acid (PubChem CID 162813892) has the molecular formula C32H30N2O12 and a molecular weight of 634.59 g/mol. Its IUPAC name is 3-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-4,5,9-trihydroxy-8-(methylamino)-2-oxa-6-azabicyclo[3.3.1]nonane-1-carboxylic acid.
| Compound Name | 3-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-4,5,9-trihydroxy-8-(methylamino)-2-oxa-6-azabicyclo[3.3.1]nonane-1-carboxylic acid |
|---|---|
| PubChem CID | 162813892 |
| Molecular Formula | C32H30N2O12 |
| Molecular Weight | 634.59 g/mol |
| Exact Mass | 634.18 |
| IUPAC Name | 3-[5,6-dihydroxy-2-[4-hydroxy-2-(2-phenylethenyl)phenyl]-4-oxochromen-7-yl]oxy-4,5,9-trihydroxy-8-(methylamino)-2-oxa-6-azabicyclo[3.3.1]nonane-1-carboxylic acid |
| SMILES | CNC1CNC2(O)C(O)C(Oc3cc4oc(-c5ccc(O)cc5C=Cc5ccccc5)cc(=O)c4c(O)c3O)OC1(C(=O)O)C2O |
| InChI | InChI=1S/C32H30N2O12/c1-33-23-14-34-32(43)27(39)28(46-31(23,29(32)40)30(41)42)45-22-13-21-24(26(38)25(22)37)19(36)12-20(44-21)18-10-9-17(35)11-16(18)8-7-15-5-3-2-4-6-15/h2-13,23,27-29,33-35,37-40,43H,14H2,1H3,(H,41,42) |
| InChIKey | ORLOABGDSBFAHB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 231.41 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.59 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|