C24H32O3 — CID 162814315
16-acetyl-8,8,13,17-tetramethyl-7-oxatetracyclo[10.7.0.03,9.013,17]nonadeca-1(12),2,4-trien-6-one (PubChem CID 162814315) has the molecular formula C24H32O3 and a molecular weight of 368.52 g/mol. Its IUPAC name is 16-acetyl-8,8,13,17-tetramethyl-7-oxatetracyclo[10.7.0.03,9.013,17]nonadeca-1(12),2,4-trien-6-one.
| Compound Name | 16-acetyl-8,8,13,17-tetramethyl-7-oxatetracyclo[10.7.0.03,9.013,17]nonadeca-1(12),2,4-trien-6-one |
|---|---|
| PubChem CID | 162814315 |
| Molecular Formula | C24H32O3 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | 16-acetyl-8,8,13,17-tetramethyl-7-oxatetracyclo[10.7.0.03,9.013,17]nonadeca-1(12),2,4-trien-6-one |
| SMILES | CC(=O)C1CCC2(C)C3=C(C=C4C=CC(=O)OC(C)(C)C4CC3)CCC12C |
| InChI | InChI=1S/C24H32O3/c1-15(25)18-11-13-24(5)20-8-7-19-16(6-9-21(26)27-22(19,2)3)14-17(20)10-12-23(18,24)4/h6,9,14,18-19H,7-8,10-13H2,1-5H3 |
| InChIKey | KRGINONPUAFUGF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |