C25H40O5 — CID 162814386
5-[2-(1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl)ethyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde (PubChem CID 162814386) has the molecular formula C25H40O5 and a molecular weight of 420.59 g/mol. Its IUPAC name is 5-[2-(1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl)ethyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde.
| Compound Name | 5-[2-(1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl)ethyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde |
|---|---|
| PubChem CID | 162814386 |
| Molecular Formula | C25H40O5 |
| Molecular Weight | 420.59 g/mol |
| Exact Mass | 420.29 |
| IUPAC Name | 5-[2-(1-hydroxy-4,6,6-trimethylspiro[2,5-dioxabicyclo[2.2.2]octane-3,6'-oxane]-3'-yl)ethyl]-2,6,6-trimethylcyclohexene-1-carbaldehyde |
| SMILES | CC1=C(C=O)C(C)(C)C(CCC2CCC3(OC2)OC2(O)CCC3(C)OC2(C)C)CC1 |
| InChI | InChI=1S/C25H40O5/c1-17-7-9-19(21(2,3)20(17)15-26)10-8-18-11-12-25(28-16-18)23(6)13-14-24(27,30-25)22(4,5)29-23/h15,18-19,27H,7-14,16H2,1-6H3 |
| InChIKey | YVVBWHWZYRDAJE-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|