C11H12O4 — CID 162815294
4-hydroxy-6-(5-hydroxypenta-1,3-dienyl)-3-methylpyran-2-one (PubChem CID 162815294) has the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. Its IUPAC name is 4-hydroxy-6-(5-hydroxypenta-1,3-dienyl)-3-methylpyran-2-one.
| Compound Name | 4-hydroxy-6-(5-hydroxypenta-1,3-dienyl)-3-methylpyran-2-one |
|---|---|
| PubChem CID | 162815294 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 4-hydroxy-6-(5-hydroxypenta-1,3-dienyl)-3-methylpyran-2-one |
| SMILES | Cc1c(O)cc(C=CC=CCO)oc1=O |
| InChI | InChI=1S/C11H12O4/c1-8-10(13)7-9(15-11(8)14)5-3-2-4-6-12/h2-5,7,12-13H,6H2,1H3 |
| InChIKey | WFMDIXFEJCSMIL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|