C11H9F3O — CID 151382014
(2E,4E)-5-(2,4,6-trifluorophenyl)penta-2,4-dien-1-ol (PubChem CID 151382014) has the molecular formula C11H9F3O and a molecular weight of 214.19 g/mol. Its IUPAC name is (2E,4E)-5-(2,4,6-trifluorophenyl)penta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-5-(2,4,6-trifluorophenyl)penta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 151382014 |
| Molecular Formula | C11H9F3O |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | (2E,4E)-5-(2,4,6-trifluorophenyl)penta-2,4-dien-1-ol |
| SMILES | OC/C=C/C=C/c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C11H9F3O/c12-8-6-10(13)9(11(14)7-8)4-2-1-3-5-15/h1-4,6-7,15H,5H2/b3-1+,4-2+ |
| InChIKey | OSPOLKLPXQYRFU-ZPUQHVIOSA-N |
| XLogP | 2.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|