C33H44O6 — CID 162816289
(3Z,5Z,7Z,9Z,12S,13Z,15Z,17R,20S,22S)-12,20-dihydroxy-22-[(1R,2R)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]-3,13,17-trimethyl-1-oxacyclodocosa-3,5,7,9,13,15-hexaen-2-one (PubChem CID 162816289) has the molecular formula C33H44O6 and a molecular weight of 536.71 g/mol. Its IUPAC name is (3Z,5Z,7Z,9Z,12S,13Z,15Z,17R,20S,22S)-12,20-dihydroxy-22-[(1R,2R)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]-3,13,17-trimethyl-1-oxacyclodocosa-3,5,7,9,13,15-hexaen-2-one.
| Compound Name | (3Z,5Z,7Z,9Z,12S,13Z,15Z,17R,20S,22S)-12,20-dihydroxy-22-[(1R,2R)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]-3,13,17-trimethyl-1-oxacyclodocosa-3,5,7,9,13,15-hexaen-2-one |
|---|---|
| PubChem CID | 162816289 |
| Molecular Formula | C33H44O6 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | (3Z,5Z,7Z,9Z,12S,13Z,15Z,17R,20S,22S)-12,20-dihydroxy-22-[(1R,2R)-1-hydroxy-1-(3-hydroxyphenyl)propan-2-yl]-3,13,17-trimethyl-1-oxacyclodocosa-3,5,7,9,13,15-hexaen-2-one |
| SMILES | C/C1=C/C=C\C=C/C=C\C[C@H](O)/C(C)=C\C=C/[C@H](C)CC[C@H](O)C[C@@H]([C@H](C)[C@@H](O)c2cccc(O)c2)OC1=O |
| InChI | InChI=1S/C33H44O6/c1-23-13-11-15-24(2)30(36)18-10-8-6-5-7-9-14-25(3)33(38)39-31(22-29(35)20-19-23)26(4)32(37)27-16-12-17-28(34)21-27/h5-17,21,23,26,29-32,34-37H,18-20,22H2,1-4H3/b6-5-,9-7-,10-8-,13-11-,24-15-,25-14-/t23-,26-,29-,30-,31-,32+/m0/s1 |
| InChIKey | YNAQNPGWTKBAKU-ADWLNGJLSA-N |
| XLogP | 6.02 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |