C36H44O11 — CID 162817251
(5,6,13,14-tetraacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl 2-phenylacetate (PubChem CID 162817251) has the molecular formula C36H44O11 and a molecular weight of 652.74 g/mol. Its IUPAC name is (5,6,13,14-tetraacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl 2-phenylacetate.
| Compound Name | (5,6,13,14-tetraacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl 2-phenylacetate |
|---|---|
| PubChem CID | 162817251 |
| Molecular Formula | C36H44O11 |
| Molecular Weight | 652.74 g/mol |
| Exact Mass | 652.29 |
| IUPAC Name | (5,6,13,14-tetraacetyloxy-1-hydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl 2-phenylacetate |
| SMILES | CC(=O)OC1C(C)=CC2C1(OC(C)=O)CC(COC(=O)Cc1ccccc1)=CC1C3C(C)(C)C3(OC(C)=O)C(OC(C)=O)C(C)C12O |
| InChI | InChI=1S/C36H44O11/c1-19-14-28-34(46-23(5)39,31(19)44-21(3)37)17-26(18-43-29(41)16-25-12-10-9-11-13-25)15-27-30-33(7,8)36(30,47-24(6)40)32(45-22(4)38)20(2)35(27,28)42/h9-15,20,27-28,30-32,42H,16-18H2,1-8H3 |
| InChIKey | JGPFYIOBZPVWHS-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 151.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.74 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|