C26H36O8 — CID 541019
(13,14-diacetyloxy-1,5-dihydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl acetate (PubChem CID 541019) has the molecular formula C26H36O8 and a molecular weight of 476.57 g/mol. Its IUPAC name is (13,14-diacetyloxy-1,5-dihydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl acetate.
| Compound Name | (13,14-diacetyloxy-1,5-dihydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl acetate |
|---|---|
| PubChem CID | 541019 |
| Molecular Formula | C26H36O8 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | (13,14-diacetyloxy-1,5-dihydroxy-4,12,12,15-tetramethyl-8-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl)methyl acetate |
| SMILES | CC(=O)OCC1=CC2C3C(C)(C)C3(OC(C)=O)C(OC(C)=O)C(C)C2(O)C2C=C(C)C(O)C2C1 |
| InChI | InChI=1S/C26H36O8/c1-12-8-19-18(21(12)30)9-17(11-32-14(3)27)10-20-22-24(6,7)26(22,34-16(5)29)23(33-15(4)28)13(2)25(19,20)31/h8,10,13,18-23,30-31H,9,11H2,1-7H3 |
| InChIKey | CHUFDDPQTDAMSY-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|