C25H38O7 — CID 162817281
[(1S,2R,3aR,4S,5R,6E,11R,12E,13aS)-11-acetyloxy-3a,4-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] propanoate (PubChem CID 162817281) has the molecular formula C25H38O7 and a molecular weight of 450.57 g/mol. Its IUPAC name is [(1S,2R,3aR,4S,5R,6E,11R,12E,13aS)-11-acetyloxy-3a,4-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] propanoate.
| Compound Name | [(1S,2R,3aR,4S,5R,6E,11R,12E,13aS)-11-acetyloxy-3a,4-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] propanoate |
|---|---|
| PubChem CID | 162817281 |
| Molecular Formula | C25H38O7 |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | [(1S,2R,3aR,4S,5R,6E,11R,12E,13aS)-11-acetyloxy-3a,4-dihydroxy-2,5,8,8,12-pentamethyl-9-oxo-1,2,3,4,5,10,11,13a-octahydrocyclopenta[12]annulen-1-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1[C@H](C)C[C@]2(O)[C@@H](O)[C@H](C)/C=C/C(C)(C)C(=O)C[C@@H](OC(C)=O)/C(C)=C/[C@@H]12 |
| InChI | InChI=1S/C25H38O7/c1-8-21(28)32-22-16(4)13-25(30)18(22)11-15(3)19(31-17(5)26)12-20(27)24(6,7)10-9-14(2)23(25)29/h9-11,14,16,18-19,22-23,29-30H,8,12-13H2,1-7H3/b10-9+,15-11+/t14-,16-,18+,19-,22+,23+,25-/m1/s1 |
| InChIKey | IWDCEGRARWUNHH-SFCXZUONSA-N |
| XLogP | 3.13 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|