C30H36O10 — CID 162821038
(9S)-7-[(2S,5S)-3,4-dimethoxy-4,5,6-trimethyloxan-2-yl]oxy-1,4,6,9-tetrahydroxy-9,10-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 162821038) has the molecular formula C30H36O10 and a molecular weight of 556.61 g/mol. Its IUPAC name is (9S)-7-[(2S,5S)-3,4-dimethoxy-4,5,6-trimethyloxan-2-yl]oxy-1,4,6,9-tetrahydroxy-9,10-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (9S)-7-[(2S,5S)-3,4-dimethoxy-4,5,6-trimethyloxan-2-yl]oxy-1,4,6,9-tetrahydroxy-9,10-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 162821038 |
| Molecular Formula | C30H36O10 |
| Molecular Weight | 556.61 g/mol |
| Exact Mass | 556.23 |
| IUPAC Name | (9S)-7-[(2S,5S)-3,4-dimethoxy-4,5,6-trimethyloxan-2-yl]oxy-1,4,6,9-tetrahydroxy-9,10-dimethyl-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | COC1[C@H](OC2C[C@](C)(O)C(C)c3cc4c(c(O)c32)C(=O)c2c(O)ccc(O)c2C4=O)OC(C)[C@H](C)C1(C)OC |
| InChI | InChI=1S/C30H36O10/c1-12-14(3)39-28(27(37-6)30(12,5)38-7)40-19-11-29(4,36)13(2)15-10-16-21(25(34)20(15)19)26(35)23-18(32)9-8-17(31)22(23)24(16)33/h8-10,12-14,19,27-28,31-32,34,36H,11H2,1-7H3/t12-,13?,14?,19?,27?,28-,29-,30?/m0/s1 |
| InChIKey | IQFZCCKGECRMKZ-HTSUXFOMSA-N |
| XLogP | 3.70 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|