C23H37NO7 — CID 162823049
11-ethyl-6-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,8,16,18-pentol (PubChem CID 162823049) has the molecular formula C23H37NO7 and a molecular weight of 439.55 g/mol. Its IUPAC name is 11-ethyl-6-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,8,16,18-pentol.
| Compound Name | 11-ethyl-6-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,8,16,18-pentol |
|---|---|
| PubChem CID | 162823049 |
| Molecular Formula | C23H37NO7 |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 439.26 |
| IUPAC Name | 11-ethyl-6-methoxy-13-(methoxymethyl)-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-3,4,8,16,18-pentol |
| SMILES | CCN1CC2(COC)CCC(O)C34C1C(C(O)C23)C1(O)CC(OC)C2CC4C1(O)C2O |
| InChI | InChI=1S/C23H37NO7/c1-4-24-9-20(10-30-2)6-5-14(25)22-13-7-11-12(31-3)8-21(28,23(13,29)19(11)27)15(18(22)24)16(26)17(20)22/h11-19,25-29H,4-10H2,1-3H3 |
| InChIKey | IBLZVTWOJQLRST-UHFFFAOYSA-N |
| XLogP | -1.04 |
| TPSA | 122.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |