C22H28N2O2 — CID 162825384
1-(3,16,20-trimethyl-15-oxa-3,20-diazapentacyclo[10.7.1.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-17-yl)ethanone (PubChem CID 162825384) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is 1-(3,16,20-trimethyl-15-oxa-3,20-diazapentacyclo[10.7.1.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-17-yl)ethanone.
| Compound Name | 1-(3,16,20-trimethyl-15-oxa-3,20-diazapentacyclo[10.7.1.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-17-yl)ethanone |
|---|---|
| PubChem CID | 162825384 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 1-(3,16,20-trimethyl-15-oxa-3,20-diazapentacyclo[10.7.1.02,10.04,9.013,18]icosa-2(10),4,6,8-tetraen-17-yl)ethanone |
| SMILES | CC(=O)C1C(C)OCC2C1CC1c3c(c4ccccc4n3C)CC2N1C |
| InChI | InChI=1S/C22H28N2O2/c1-12(25)21-13(2)26-11-17-15(21)9-20-22-16(10-19(17)23(20)3)14-7-5-6-8-18(14)24(22)4/h5-8,13,15,17,19-21H,9-11H2,1-4H3 |
| InChIKey | HDWJJWIIAAZFAK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|