C27H40N2O2Si — CID 11048684
3-[(1S,12S,13R,14R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,16-dimethyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one (PubChem CID 11048684) has the molecular formula C27H40N2O2Si and a molecular weight of 452.72 g/mol. Its IUPAC name is 3-[(1S,12S,13R,14R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,16-dimethyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one.
| Compound Name | 3-[(1S,12S,13R,14R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,16-dimethyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 11048684 |
| Molecular Formula | C27H40N2O2Si |
| Molecular Weight | 452.72 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 3-[(1S,12S,13R,14R)-13-[[tert-butyl(dimethyl)silyl]oxymethyl]-3,16-dimethyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)[C@@H]1C[C@H]2c3c(c4ccccc4n3C)C[C@@H]([C@@H]1CO[Si](C)(C)C(C)(C)C)N2C |
| InChI | InChI=1S/C27H40N2O2Si/c1-17(18(2)30)20-14-25-26-21(19-12-10-11-13-23(19)29(26)7)15-24(28(25)6)22(20)16-31-32(8,9)27(3,4)5/h10-13,20,22,24-25H,1,14-16H2,2-9H3/t20-,22+,24-,25-/m0/s1 |
| InChIKey | BHSMMICDVFIPEX-OZTAZYLFSA-N |
| XLogP | 5.88 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.72 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|