C35H48N2O3Si — CID 11813834
[(Z)-2-[(1S,12S,13S,14R)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-1-enoxy]-tert-butyl-dimethylsilane (PubChem CID 11813834) has the molecular formula C35H48N2O3Si and a molecular weight of 572.87 g/mol. Its IUPAC name is [(Z)-2-[(1S,12S,13S,14R)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-1-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(Z)-2-[(1S,12S,13S,14R)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-1-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11813834 |
| Molecular Formula | C35H48N2O3Si |
| Molecular Weight | 572.87 g/mol |
| Exact Mass | 572.34 |
| IUPAC Name | [(Z)-2-[(1S,12S,13S,14R)-16-benzyl-13-(1,3-dioxolan-2-yl)-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-1-enoxy]-tert-butyl-dimethylsilane |
| SMILES | CC/C(=C/O[Si](C)(C)C(C)(C)C)[C@@H]1C[C@H]2c3c(c4ccccc4n3C)C[C@@H]([C@H]1C1OCCO1)N2Cc1ccccc1 |
| InChI | InChI=1S/C35H48N2O3Si/c1-8-25(23-40-41(6,7)35(2,3)4)27-20-31-33-28(26-16-12-13-17-29(26)36(33)5)21-30(32(27)34-38-18-19-39-34)37(31)22-24-14-10-9-11-15-24/h9-17,23,27,30-32,34H,8,18-22H2,1-7H3/b25-23-/t27-,30-,31-,32-/m0/s1 |
| InChIKey | YBUAXRJCEQCJMM-QKIOKVOZSA-N |
| XLogP | 7.97 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.87 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|