C28H35N3O3 — CID 100942164
tert-butyl N-[[(1S,12S,13R,14R)-16-benzyl-14-hydroxy-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-yl]methyl]carbamate (PubChem CID 100942164) has the molecular formula C28H35N3O3 and a molecular weight of 461.61 g/mol. Its IUPAC name is tert-butyl N-[[(1S,12S,13R,14R)-16-benzyl-14-hydroxy-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(1S,12S,13R,14R)-16-benzyl-14-hydroxy-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-yl]methyl]carbamate |
|---|---|
| PubChem CID | 100942164 |
| Molecular Formula | C28H35N3O3 |
| Molecular Weight | 461.61 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl N-[[(1S,12S,13R,14R)-16-benzyl-14-hydroxy-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-yl]methyl]carbamate |
| SMILES | Cn1c2c(c3ccccc31)C[C@H]1[C@@H](CNC(=O)OC(C)(C)C)[C@H](O)C[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C28H35N3O3/c1-28(2,3)34-27(33)29-16-21-23-14-20-19-12-8-9-13-22(19)30(4)26(20)24(15-25(21)32)31(23)17-18-10-6-5-7-11-18/h5-13,21,23-25,32H,14-17H2,1-4H3,(H,29,33)/t21-,23+,24+,25-/m1/s1 |
| InChIKey | KTCPCJDKNXUKDC-DDKRZIBASA-N |
| XLogP | 4.55 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.61 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|