C29H29ClN2O2S — CID 10413814
(1S,12S)-13-[benzenesulfinyl(chloro)methyl]-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-ol (PubChem CID 10413814) has the molecular formula C29H29ClN2O2S and a molecular weight of 505.08 g/mol. Its IUPAC name is (1S,12S)-13-[benzenesulfinyl(chloro)methyl]-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-ol.
| Compound Name | (1S,12S)-13-[benzenesulfinyl(chloro)methyl]-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-ol |
|---|---|
| PubChem CID | 10413814 |
| Molecular Formula | C29H29ClN2O2S |
| Molecular Weight | 505.08 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (1S,12S)-13-[benzenesulfinyl(chloro)methyl]-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-13-ol |
| SMILES | Cn1c2c(c3ccccc31)C[C@@H]1N(Cc3ccccc3)[C@H]2CCC1(O)C(Cl)S(=O)c1ccccc1 |
| InChI | InChI=1S/C29H29ClN2O2S/c1-31-24-15-9-8-14-22(24)23-18-26-29(33,28(30)35(34)21-12-6-3-7-13-21)17-16-25(27(23)31)32(26)19-20-10-4-2-5-11-20/h2-15,25-26,28,33H,16-19H2,1H3/t25-,26-,28?,29?,35?/m0/s1 |
| InChIKey | ACQPKMZVRVEICU-AZYAYYOTSA-N |
| XLogP | 5.54 |
| TPSA | 45.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.08 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|