C26H28N4O — CID 10501841
4-[(1S,3S)-2-benzyl-3-(cyanomethyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3-methoxybutanenitrile (PubChem CID 10501841) has the molecular formula C26H28N4O and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-[(1S,3S)-2-benzyl-3-(cyanomethyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3-methoxybutanenitrile.
| Compound Name | 4-[(1S,3S)-2-benzyl-3-(cyanomethyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3-methoxybutanenitrile |
|---|---|
| PubChem CID | 10501841 |
| Molecular Formula | C26H28N4O |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 4-[(1S,3S)-2-benzyl-3-(cyanomethyl)-9-methyl-3,4-dihydro-1H-pyrido[3,4-b]indol-1-yl]-3-methoxybutanenitrile |
| SMILES | COC(CC#N)C[C@H]1c2c(c3ccccc3n2C)C[C@@H](CC#N)N1Cc1ccccc1 |
| InChI | InChI=1S/C26H28N4O/c1-29-24-11-7-6-10-22(24)23-16-20(12-14-27)30(18-19-8-4-3-5-9-19)25(26(23)29)17-21(31-2)13-15-28/h3-11,20-21,25H,12-13,16-18H2,1-2H3/t20-,21?,25+/m1/s1 |
| InChIKey | JQEHJYLIVLFCAE-JQACKWFESA-N |
| XLogP | 4.88 |
| TPSA | 64.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|