C30H36N2O — CID 10813019
(1R,12R,13R,14R)-16-benzyl-14-[(E)-hept-4-en-3-yl]-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carbaldehyde (PubChem CID 10813019) has the molecular formula C30H36N2O and a molecular weight of 440.63 g/mol. Its IUPAC name is (1R,12R,13R,14R)-16-benzyl-14-[(E)-hept-4-en-3-yl]-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carbaldehyde.
| Compound Name | (1R,12R,13R,14R)-16-benzyl-14-[(E)-hept-4-en-3-yl]-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carbaldehyde |
|---|---|
| PubChem CID | 10813019 |
| Molecular Formula | C30H36N2O |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.28 |
| IUPAC Name | (1R,12R,13R,14R)-16-benzyl-14-[(E)-hept-4-en-3-yl]-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraene-13-carbaldehyde |
| SMILES | CC/C=C/C(CC)[C@H]1C[C@@H]2c3c(c4ccccc4n3C)C[C@H]([C@@H]1C=O)N2Cc1ccccc1 |
| InChI | InChI=1S/C30H36N2O/c1-4-6-14-22(5-2)24-17-29-30-25(23-15-10-11-16-27(23)31(30)3)18-28(26(24)20-33)32(29)19-21-12-8-7-9-13-21/h6-16,20,22,24,26,28-29H,4-5,17-19H2,1-3H3/b14-6+/t22?,24-,26-,28-,29-/m1/s1 |
| InChIKey | PBQIKXCNGARJGX-SACKWXFFSA-N |
| XLogP | 6.47 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|