C26H28N2O — CID 10407701
(1R)-1-[(1S,12S)-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8,13-pentaen-13-yl]but-3-en-1-ol (PubChem CID 10407701) has the molecular formula C26H28N2O and a molecular weight of 384.52 g/mol. Its IUPAC name is (1R)-1-[(1S,12S)-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8,13-pentaen-13-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(1S,12S)-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8,13-pentaen-13-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 10407701 |
| Molecular Formula | C26H28N2O |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | (1R)-1-[(1S,12S)-16-benzyl-3-methyl-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8,13-pentaen-13-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)C1=CC[C@H]2c3c(c4ccccc4n3C)C[C@@H]1N2Cc1ccccc1 |
| InChI | InChI=1S/C26H28N2O/c1-3-9-25(29)20-14-15-23-26-21(19-12-7-8-13-22(19)27(26)2)16-24(20)28(23)17-18-10-5-4-6-11-18/h3-8,10-14,23-25,29H,1,9,15-17H2,2H3/t23-,24-,25+/m0/s1 |
| InChIKey | RREOBXNNWZZVBL-CCDWMCETSA-N |
| XLogP | 4.91 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|