C40H45N3O5 — CID 59824361
tert-butyl N-[[1-benzyl-6-cyano-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methyl]carbamate (PubChem CID 59824361) has the molecular formula C40H45N3O5 and a molecular weight of 647.82 g/mol. Its IUPAC name is tert-butyl N-[[1-benzyl-6-cyano-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-benzyl-6-cyano-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 59824361 |
| Molecular Formula | C40H45N3O5 |
| Molecular Weight | 647.82 g/mol |
| Exact Mass | 647.34 |
| IUPAC Name | tert-butyl N-[[1-benzyl-6-cyano-3,4,5-tris(phenylmethoxy)piperidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCC1C(OCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C(C#N)N1Cc1ccccc1 |
| InChI | InChI=1S/C40H45N3O5/c1-40(2,3)48-39(44)42-25-35-37(46-28-32-20-12-6-13-21-32)38(47-29-33-22-14-7-15-23-33)36(45-27-31-18-10-5-11-19-31)34(24-41)43(35)26-30-16-8-4-9-17-30/h4-23,34-38H,25-29H2,1-3H3,(H,42,44) |
| InChIKey | YGWYNDHWHIBABX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 93.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.82 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |