C24H43NO6Si2 — CID 12002846
tert-butyl N-[[(3R,4R,5S,6R)-6-phenylmethoxy-4,5-bis(trimethylsilyloxy)oxan-3-yl]methyl]carbamate (PubChem CID 12002846) has the molecular formula C24H43NO6Si2 and a molecular weight of 497.78 g/mol. Its IUPAC name is tert-butyl N-[[(3R,4R,5S,6R)-6-phenylmethoxy-4,5-bis(trimethylsilyloxy)oxan-3-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[(3R,4R,5S,6R)-6-phenylmethoxy-4,5-bis(trimethylsilyloxy)oxan-3-yl]methyl]carbamate |
|---|---|
| PubChem CID | 12002846 |
| Molecular Formula | C24H43NO6Si2 |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 497.26 |
| IUPAC Name | tert-butyl N-[[(3R,4R,5S,6R)-6-phenylmethoxy-4,5-bis(trimethylsilyloxy)oxan-3-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC[C@@H]1CO[C@H](OCc2ccccc2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C24H43NO6Si2/c1-24(2,3)29-23(26)25-15-19-17-28-22(27-16-18-13-11-10-12-14-18)21(31-33(7,8)9)20(19)30-32(4,5)6/h10-14,19-22H,15-17H2,1-9H3,(H,25,26)/t19-,20-,21+,22+/m1/s1 |
| InChIKey | NBMFRQPWFUUWPU-CZYKHXBRSA-N |
| XLogP | 5.14 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|