C20H26O6 — CID 11728162
tert-butyl (3aS,6R,7R,7aS)-7-hydroxy-2-methyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyran-3-carboxylate (PubChem CID 11728162) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is tert-butyl (3aS,6R,7R,7aS)-7-hydroxy-2-methyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyran-3-carboxylate.
| Compound Name | tert-butyl (3aS,6R,7R,7aS)-7-hydroxy-2-methyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyran-3-carboxylate |
|---|---|
| PubChem CID | 11728162 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | tert-butyl (3aS,6R,7R,7aS)-7-hydroxy-2-methyl-6-phenylmethoxy-4,6,7,7a-tetrahydro-3aH-furo[3,2-c]pyran-3-carboxylate |
| SMILES | CC1=C(C(=O)OC(C)(C)C)[C@H]2CO[C@H](OCc3ccccc3)[C@H](O)[C@H]2O1 |
| InChI | InChI=1S/C20H26O6/c1-12-15(18(22)26-20(2,3)4)14-11-24-19(16(21)17(14)25-12)23-10-13-8-6-5-7-9-13/h5-9,14,16-17,19,21H,10-11H2,1-4H3/t14-,16-,17+,19+/m1/s1 |
| InChIKey | KDTFSKPZVNPDBB-NWGLXNPWSA-N |
| XLogP | 2.55 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |