C30H46N2O2Si — CID 101198770
3-[(1R,12R,13S,14S)-3,16-dimethyl-13-[tri(propan-2-yl)silyloxymethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one (PubChem CID 101198770) has the molecular formula C30H46N2O2Si and a molecular weight of 494.80 g/mol. Its IUPAC name is 3-[(1R,12R,13S,14S)-3,16-dimethyl-13-[tri(propan-2-yl)silyloxymethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one.
| Compound Name | 3-[(1R,12R,13S,14S)-3,16-dimethyl-13-[tri(propan-2-yl)silyloxymethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 101198770 |
| Molecular Formula | C30H46N2O2Si |
| Molecular Weight | 494.80 g/mol |
| Exact Mass | 494.33 |
| IUPAC Name | 3-[(1R,12R,13S,14S)-3,16-dimethyl-13-[tri(propan-2-yl)silyloxymethyl]-3,16-diazatetracyclo[10.3.1.02,10.04,9]hexadeca-2(10),4,6,8-tetraen-14-yl]but-3-en-2-one |
| SMILES | C=C(C(C)=O)[C@H]1C[C@@H]2c3c(c4ccccc4n3C)C[C@H]([C@H]1CO[Si](C(C)C)(C(C)C)C(C)C)N2C |
| InChI | InChI=1S/C30H46N2O2Si/c1-18(2)35(19(3)4,20(5)6)34-17-26-24(21(7)22(8)33)15-29-30-25(16-28(26)31(29)9)23-13-11-12-14-27(23)32(30)10/h11-14,18-20,24,26,28-29H,7,15-17H2,1-6,8-10H3/t24-,26+,28-,29-/m1/s1 |
| InChIKey | JEGGLGYRNNHDEF-OVCWXOKGSA-N |
| XLogP | 7.05 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.80 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|