C38H58O5 — CID 162827955
13-hexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one (PubChem CID 162827955) has the molecular formula C38H58O5 and a molecular weight of 594.88 g/mol. Its IUPAC name is 13-hexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one.
| Compound Name | 13-hexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one |
|---|---|
| PubChem CID | 162827955 |
| Molecular Formula | C38H58O5 |
| Molecular Weight | 594.88 g/mol |
| Exact Mass | 594.43 |
| IUPAC Name | 13-hexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one |
| SMILES | CCCCCCC12CCC(O)C(C)(CO)C1CCC1(C)C2C(=O)C=C2C3CC4(C)CCC#CC(O)C3(CC4)C(O)CC21C |
| InChI | InChI=1S/C38H58O5/c1-6-7-8-10-16-37-18-14-29(41)34(3,24-39)28(37)13-17-35(4)32(37)27(40)21-25-26-22-33(2)15-11-9-12-30(42)38(26,20-19-33)31(43)23-36(25,35)5/h21,26,28-32,39,41-43H,6-8,10-11,13-20,22-24H2,1-5H3 |
| InChIKey | OHZIQESAJXZTJB-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.88 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|