C38H56O5 — CID 163038843
13-cyclohexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one (PubChem CID 163038843) has the molecular formula C38H56O5 and a molecular weight of 592.86 g/mol. Its IUPAC name is 13-cyclohexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one.
| Compound Name | 13-cyclohexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one |
|---|---|
| PubChem CID | 163038843 |
| Molecular Formula | C38H56O5 |
| Molecular Weight | 592.86 g/mol |
| Exact Mass | 592.41 |
| IUPAC Name | 13-cyclohexyl-2,10,25-trihydroxy-9-(hydroxymethyl)-4,5,9,20-tetramethylhexacyclo[18.5.2.01,18.04,17.05,14.08,13]heptacos-16-en-23-yn-15-one |
| SMILES | CC12CCC#CC(O)C3(CC1)C(O)CC1(C)C(=CC(=O)C4C5(C6CCCCC6)CCC(O)C(C)(CO)C5CCC41C)C3C2 |
| InChI | InChI=1S/C38H56O5/c1-33-15-9-8-12-30(42)38(19-18-33)26(21-33)25-20-27(40)32-35(3,36(25,4)22-31(38)43)16-13-28-34(2,23-39)29(41)14-17-37(28,32)24-10-6-5-7-11-24/h20,24,26,28-32,39,41-43H,5-7,9-11,13-19,21-23H2,1-4H3 |
| InChIKey | LYGWOGKVPARDLL-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.86 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|