C36H50O6 — CID 162836372
9-(1,2-dihydroxyethyl)-2,26,30-trihydroxy-4,5,14,21-tetramethylheptacyclo[19.5.2.29,13.01,19.04,18.05,15.08,14]triaconta-11,17-dien-24-yn-16-one (PubChem CID 162836372) has the molecular formula C36H50O6 and a molecular weight of 578.79 g/mol. Its IUPAC name is 9-(1,2-dihydroxyethyl)-2,26,30-trihydroxy-4,5,14,21-tetramethylheptacyclo[19.5.2.29,13.01,19.04,18.05,15.08,14]triaconta-11,17-dien-24-yn-16-one.
| Compound Name | 9-(1,2-dihydroxyethyl)-2,26,30-trihydroxy-4,5,14,21-tetramethylheptacyclo[19.5.2.29,13.01,19.04,18.05,15.08,14]triaconta-11,17-dien-24-yn-16-one |
|---|---|
| PubChem CID | 162836372 |
| Molecular Formula | C36H50O6 |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.36 |
| IUPAC Name | 9-(1,2-dihydroxyethyl)-2,26,30-trihydroxy-4,5,14,21-tetramethylheptacyclo[19.5.2.29,13.01,19.04,18.05,15.08,14]triaconta-11,17-dien-24-yn-16-one |
| SMILES | CC12CCC#CC(O)C3(CC1)C(O)CC1(C)C(=CC(=O)C4C5(C)C6C=CCC(C(O)CO)(C(O)C6)C5CCC41C)C3C2 |
| InChI | InChI=1S/C36H50O6/c1-31-11-6-5-9-26(39)35(15-14-31)23(18-31)22-17-24(38)30-32(2,33(22,3)19-28(35)41)13-10-25-34(30,4)21-8-7-12-36(25,27(40)16-21)29(42)20-37/h7-8,17,21,23,25-30,37,39-42H,6,10-16,18-20H2,1-4H3 |
| InChIKey | KVIQCEXDFMCCJK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 118.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|