C28H30O9 — CID 162829057
7-(furan-3-yl)-24-hydroxy-8,19,19-trimethyl-3,6,14,18-tetraoxaheptacyclo[18.3.2.01,11.02,4.02,8.012,17.012,20]pentacos-21-ene-5,15,25-trione (PubChem CID 162829057) has the molecular formula C28H30O9 and a molecular weight of 510.54 g/mol. Its IUPAC name is 7-(furan-3-yl)-24-hydroxy-8,19,19-trimethyl-3,6,14,18-tetraoxaheptacyclo[18.3.2.01,11.02,4.02,8.012,17.012,20]pentacos-21-ene-5,15,25-trione.
| Compound Name | 7-(furan-3-yl)-24-hydroxy-8,19,19-trimethyl-3,6,14,18-tetraoxaheptacyclo[18.3.2.01,11.02,4.02,8.012,17.012,20]pentacos-21-ene-5,15,25-trione |
|---|---|
| PubChem CID | 162829057 |
| Molecular Formula | C28H30O9 |
| Molecular Weight | 510.54 g/mol |
| Exact Mass | 510.19 |
| IUPAC Name | 7-(furan-3-yl)-24-hydroxy-8,19,19-trimethyl-3,6,14,18-tetraoxaheptacyclo[18.3.2.01,11.02,4.02,8.012,17.012,20]pentacos-21-ene-5,15,25-trione |
| SMILES | CC1(C)OC2CC(=O)OCC23C2CCC4(C)C(c5ccoc5)OC(=O)C5OC54C24CC=CC13C(=O)C4O |
| InChI | InChI=1S/C28H30O9/c1-23(2)27-8-4-7-25(18(30)19(27)31)15(26(27)13-34-17(29)11-16(26)36-23)5-9-24(3)20(14-6-10-33-12-14)35-22(32)21-28(24,25)37-21/h4,6,8,10,12,15-16,18,20-21,30H,5,7,9,11,13H2,1-3H3 |
| InChIKey | LACMJDZYOJQRTE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.54 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|