C31H38O9 — CID 163018190
(2R,7S,10S,12S,13S,14S,16S,19S,20S)-13-cyclohexyl-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione (PubChem CID 163018190) has the molecular formula C31H38O9 and a molecular weight of 554.64 g/mol. Its IUPAC name is (2R,7S,10S,12S,13S,14S,16S,19S,20S)-13-cyclohexyl-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione.
| Compound Name | (2R,7S,10S,12S,13S,14S,16S,19S,20S)-13-cyclohexyl-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
|---|---|
| PubChem CID | 163018190 |
| Molecular Formula | C31H38O9 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | (2R,7S,10S,12S,13S,14S,16S,19S,20S)-13-cyclohexyl-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethyl-4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-5,11,17-trione |
| SMILES | CC1(C)O[C@H]2CC(=O)OC[C@]23C2CC[C@@]4(C)[C@H](c5ccoc5)OC(=O)[C@H]5O[C@@]54[C@]2(C2CCCCC2)[C@H](O)C(=O)[C@H]13 |
| InChI | InChI=1S/C31H38O9/c1-27(2)22-21(33)23(34)30(17-7-5-4-6-8-17)18(29(22)15-37-20(32)13-19(29)39-27)9-11-28(3)24(16-10-12-36-14-16)38-26(35)25-31(28,30)40-25/h10,12,14,17-19,22-25,34H,4-9,11,13,15H2,1-3H3/t18?,19-,22+,23+,24-,25+,28-,29-,30-,31-/m0/s1 |
| InChIKey | VHGSGIIFKIIHOQ-VKQNYVQUSA-N |
| XLogP | 3.67 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|