C42H50O9 — CID 162867288
13-(3-benzylcyclohexyl)-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione (PubChem CID 162867288) has the molecular formula C42H50O9 and a molecular weight of 698.85 g/mol. Its IUPAC name is 13-(3-benzylcyclohexyl)-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione.
| Compound Name | 13-(3-benzylcyclohexyl)-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione |
|---|---|
| PubChem CID | 162867288 |
| Molecular Formula | C42H50O9 |
| Molecular Weight | 698.85 g/mol |
| Exact Mass | 698.35 |
| IUPAC Name | 13-(3-benzylcyclohexyl)-19-(furan-3-yl)-12-hydroxy-9,9,20-trimethylspiro[4,8,15,18-tetraoxahexacyclo[11.9.0.02,7.02,10.014,16.014,20]docosane-6,1'-cyclopentane]-5,11,17-trione |
| SMILES | CC1(C)OC2C3(CCCC3)C(=O)OCC23C1C(=O)C(O)C1(C2CCCC(Cc4ccccc4)C2)C3CCC2(C)C(c3ccoc3)OC(=O)C3OC321 |
| InChI | InChI=1S/C42H50O9/c1-37(2)30-29(43)31(44)41(27-13-9-12-25(21-27)20-24-10-5-4-6-11-24)28(40(30)23-48-36(46)39(35(40)51-37)16-7-8-17-39)14-18-38(3)32(26-15-19-47-22-26)49-34(45)33-42(38,41)50-33/h4-6,10-11,15,19,22,25,27-28,30-33,35,44H,7-9,12-14,16-18,20-21,23H2,1-3H3 |
| InChIKey | JZHNDHYCIGBDBT-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.85 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|