C63H84N2O11 — CID 163075513
CID 163075513 (PubChem CID 163075513) has the molecular formula C63H84N2O11 and a molecular weight of 1045.37 g/mol.
| Compound Name | CID 163075513 |
|---|---|
| PubChem CID | 163075513 |
| Molecular Formula | C63H84N2O11 |
| Molecular Weight | 1045.37 g/mol |
| Exact Mass | 1044.61 |
| IUPAC Name | — |
| SMILES | CCC1CCC2(CCC3(C2)C(=O)OCC24C(C(=O)C(O)C5(C6CCCC(Cc7ccccc7)C6)C2CCC2(C)C(c6ccoc6CC(C(O)CO)C6CCC7C(C=CN8CNCC78)C6)OC(=O)C6OC625)C(C)(C)OC34)C1 |
| InChI | InChI=1S/C63H84N2O11/c1-5-36-16-21-59(30-36)22-23-60(33-59)55-61(34-73-56(60)71)48-17-20-58(4)52(43-19-25-72-47(43)29-44(46(67)32-66)39-14-15-42-40(28-39)18-24-65-35-64-31-45(42)65)74-54(70)53-63(58,75-53)62(48,51(69)49(68)50(61)57(2,3)76-55)41-13-9-12-38(27-41)26-37-10-7-6-8-11-37/h6-8,10-11,18-19,24-25,36,38-42,44-46,48,50-53,55,64,66-67,69H,5,9,12-17,20-23,26-35H2,1-4H3 |
| InChIKey | HKHBBYGUDGGCST-UHFFFAOYSA-N |
| XLogP | 8.42 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 76 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1045.37 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|