C68H86N2O11 — CID 163083910
CID 163083910 (PubChem CID 163083910) has the molecular formula C68H86N2O11 and a molecular weight of 1107.44 g/mol.
| Compound Name | CID 163083910 |
|---|---|
| PubChem CID | 163083910 |
| Molecular Formula | C68H86N2O11 |
| Molecular Weight | 1107.44 g/mol |
| Exact Mass | 1106.62 |
| IUPAC Name | — |
| SMILES | CC1(C)OC2C3(CCC4(CCC5(CCCC5)C4)C3)C(=O)OCC23C1C(=O)C(O)C12C4CC(Cc5ccccc5)CCC4C#CCC4(c5ccoc5CC(C(O)CO)C5CCC6C(C=CN7CNCC67)C5)OC(=O)C5OC51C4(C)CCC32 |
| InChI | InChI=1S/C68H86N2O11/c1-60(2)54-53(73)55(74)67-48-31-41(30-40-10-5-4-6-11-40)13-14-42(48)12-9-22-66(47-19-29-77-51(47)33-46(50(72)35-71)43-15-16-45-44(32-43)18-28-70-39-69-34-49(45)70)61(3,68(67)56(79-68)57(75)80-66)23-17-52(67)65(54)38-78-59(76)64(58(65)81-60)27-26-63(37-64)25-24-62(36-63)20-7-8-21-62/h4-6,10-11,18-19,28-29,41-46,48-50,52,54-56,58,69,71-72,74H,7-8,13-17,20-27,30-39H2,1-3H3 |
| InChIKey | UPVBWLPSDHXQOP-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1107.44 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|