About CID 163083910
CID 163083910 (PubChem CID 163083910) has the molecular formula C68H86N2O11
and a molecular weight of 1107.44 g/mol.
Molecular Properties
| Compound Name | CID 163083910 |
| PubChem CID | 163083910 |
| Molecular Formula | C68H86N2O11 |
| Molecular Weight | 1107.44 g/mol |
| Exact Mass | 1106.62 |
| IUPAC Name | — |
| SMILES | CC1(C)OC2C3(CCC4(CCC5(CCCC5)C4)C3)C(=O)OCC23C1C(=O)C(O)C12C4CC(Cc5ccccc5)CCC4C#CCC4(c5ccoc5CC(C(O)CO)C5CCC6C(C=CN7CNCC67)C5)OC(=O)C5OC51C4(C)CCC32 |
| InChI | InChI=1S/C68H86N2O11/c1-60(2)54-53(73)55(74)67-48-31-41(30-40-10-5-4-6-11-40)13-14-42(48)12-9-22-66(47-19-29-77-51(47)33-46(50(72)35-71)43-15-16-45-44(32-43)18-28-70-39-69-34-49(45)70)61(3,68(67)56(79-68)57(75)80-66)23-17-52(67)65(54)38-78-59(76)64(58(65)81-60)27-26-63(37-64)25-24-62(36-63)20-7-8-21-62/h4-6,10-11,18-19,28-29,41-46,48-50,52,54-56,58,69,71-72,74H,7-8,13-17,20-27,30-39H2,1-3H3 |
| InChIKey | UPVBWLPSDHXQOP-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 81 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1107.44 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 163083910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163083910?
The IUPAC name of CID 163083910 (CID 163083910) is not available.
What is the SMILES notation for CID 163083910?
The canonical SMILES for CID 163083910 is CC1(C)OC2C3(CCC4(CCC5(CCCC5)C4)C3)C(=O)OCC23C1C(=O)C(O)C12C4CC(Cc5ccccc5)CCC4C#CCC4(c5ccoc5CC(C(O)CO)C5CCC6C(C=CN7CNCC67)C5)OC(=O)C5OC51C4(C)CCC32.
What is the InChIKey of CID 163083910?
The InChIKey is UPVBWLPSDHXQOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C68H86N2O11/c1-60(2)54-53(73)55(74)67-48-31-41(30-40-10-5-4-6-11-40)13-14-42(48)12-9-22-66(47-19-29-77-51(47)33-46(50(72)35-71)43-15-16-45-44(32-43)18-28-70-39-69-34-49(45)70)61(3,68(67)56(79-68)57(75)80-66)23-17-52(67)65(54)38-78-59(76)64(58(65)81-60)27-26-63(37-64)25-24-62(36-63)20-7-8-21-62/h4-6,10-11,18-19,28-29,41-46,48-50,52,54-56,58,69,71-72,74H,7-8,13-17,20-27,30-39H2,1-3H3.
What are the key properties of CID 163083910?
CID 163083910 has a molecular weight of 1107.44 g/mol, XLogP of 8.74, 8 rotatable bonds, 4 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163083910 is sourced from PubChem (CID 163083910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).