C66H82N2O11 — CID 162985725
CID 162985725 (PubChem CID 162985725) has the molecular formula C66H82N2O11 and a molecular weight of 1079.38 g/mol.
| Compound Name | CID 162985725 |
|---|---|
| PubChem CID | 162985725 |
| Molecular Formula | C66H82N2O11 |
| Molecular Weight | 1079.38 g/mol |
| Exact Mass | 1078.59 |
| IUPAC Name | — |
| SMILES | CC1(C)OC2C3(CCC4(CCCC4)C3)C(=O)OCC23C1C(=O)C(O)C12C4CC(Cc5ccccc5)CCC4C#CC4CCc5coc(CC(C(O)CO)C6CCC7C(C=CN8CNCC78)C6)c5C45OC(=O)C4OC41C5(C)CCC32 |
| InChI | InChI=1S/C66H82N2O11/c1-59(2)53-52(71)54(72)64-46-28-38(27-37-9-5-4-6-10-37)11-12-39(46)13-16-43-17-14-42-33-75-49(30-45(48(70)32-69)40-15-18-44-41(29-40)20-26-68-36-67-31-47(44)68)51(42)65(43)60(3,66(64)55(77-66)56(73)78-65)23-19-50(64)63(53)35-76-58(74)62(57(63)79-59)25-24-61(34-62)21-7-8-22-61/h4-6,9-10,20,26,33,38-41,43-48,50,53-55,57,67,69-70,72H,7-8,11-12,14-15,17-19,21-25,27-32,34-36H2,1-3H3 |
| InChIKey | QPZGFFUMWXSPEE-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 180.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 79 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1079.38 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|