C20H39NO3 — CID 162830701
(Z,2S,5R)-2-[(1S)-1-hydroxyethyl]-5-(methylaminomethyl)hexadec-9-enoic acid (PubChem CID 162830701) has the molecular formula C20H39NO3 and a molecular weight of 341.54 g/mol. Its IUPAC name is (Z,2S,5R)-2-[(1S)-1-hydroxyethyl]-5-(methylaminomethyl)hexadec-9-enoic acid.
| Compound Name | (Z,2S,5R)-2-[(1S)-1-hydroxyethyl]-5-(methylaminomethyl)hexadec-9-enoic acid |
|---|---|
| PubChem CID | 162830701 |
| Molecular Formula | C20H39NO3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.29 |
| IUPAC Name | (Z,2S,5R)-2-[(1S)-1-hydroxyethyl]-5-(methylaminomethyl)hexadec-9-enoic acid |
| SMILES | CCCCCC/C=C\CCC[C@H](CCC(C(=O)O)[C@H](C)O)CNC |
| InChI | InChI=1S/C20H39NO3/c1-4-5-6-7-8-9-10-11-12-13-18(16-21-3)14-15-19(17(2)22)20(23)24/h9-10,17-19,21-22H,4-8,11-16H2,1-3H3,(H,23,24)/b10-9-/t17-,18+,19?/m0/s1 |
| InChIKey | GVIOMEAINPFIEI-WNJJIRFSSA-N |
| XLogP | 4.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|