C23H45NO2 — CID 163102500
(Z,5S,7S)-5-(methylaminomethyl)-7-pentylhexadec-9-enoic acid (PubChem CID 163102500) has the molecular formula C23H45NO2 and a molecular weight of 367.62 g/mol. Its IUPAC name is (Z,5S,7S)-5-(methylaminomethyl)-7-pentylhexadec-9-enoic acid.
| Compound Name | (Z,5S,7S)-5-(methylaminomethyl)-7-pentylhexadec-9-enoic acid |
|---|---|
| PubChem CID | 163102500 |
| Molecular Formula | C23H45NO2 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 367.35 |
| IUPAC Name | (Z,5S,7S)-5-(methylaminomethyl)-7-pentylhexadec-9-enoic acid |
| SMILES | CCCCCC/C=C\C[C@H](CCCCC)C[C@H](CCCC(=O)O)CNC |
| InChI | InChI=1S/C23H45NO2/c1-4-6-8-9-10-11-13-16-21(15-12-7-5-2)19-22(20-24-3)17-14-18-23(25)26/h11,13,21-22,24H,4-10,12,14-20H2,1-3H3,(H,25,26)/b13-11-/t21-,22-/m0/s1 |
| InChIKey | OSLCIRVTDLVRRQ-DXSUYABFSA-N |
| XLogP | 6.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|