C42H52O8 — CID 162834899
6-[13,16-dihydroxy-2,6,10,10-tetramethyl-4,9-dioxo-12-(2-phenylethenyl)-18-hexacyclo[11.8.1.01,16.02,18.05,22.06,11]docosa-5(22),14-dienyl]-3,4-dihydroxy-2-methylhept-2-enoic acid (PubChem CID 162834899) has the molecular formula C42H52O8 and a molecular weight of 684.87 g/mol. Its IUPAC name is 6-[13,16-dihydroxy-2,6,10,10-tetramethyl-4,9-dioxo-12-(2-phenylethenyl)-18-hexacyclo[11.8.1.01,16.02,18.05,22.06,11]docosa-5(22),14-dienyl]-3,4-dihydroxy-2-methylhept-2-enoic acid.
| Compound Name | 6-[13,16-dihydroxy-2,6,10,10-tetramethyl-4,9-dioxo-12-(2-phenylethenyl)-18-hexacyclo[11.8.1.01,16.02,18.05,22.06,11]docosa-5(22),14-dienyl]-3,4-dihydroxy-2-methylhept-2-enoic acid |
|---|---|
| PubChem CID | 162834899 |
| Molecular Formula | C42H52O8 |
| Molecular Weight | 684.87 g/mol |
| Exact Mass | 684.37 |
| IUPAC Name | 6-[13,16-dihydroxy-2,6,10,10-tetramethyl-4,9-dioxo-12-(2-phenylethenyl)-18-hexacyclo[11.8.1.01,16.02,18.05,22.06,11]docosa-5(22),14-dienyl]-3,4-dihydroxy-2-methylhept-2-enoic acid |
| SMILES | CC(C(=O)O)=C(O)C(O)CC(C)C12CCCC34C5=C(C(=O)CC13C)C1(C)CCC(=O)C(C)(C)C1C(C=Cc1ccccc1)C5(O)C=CC4(O)C2 |
| InChI | InChI=1S/C42H52O8/c1-24(21-28(43)32(46)25(2)35(47)48)39-16-10-17-42-34-31(29(44)22-38(39,42)6)37(5)18-15-30(45)36(3,4)33(37)27(14-13-26-11-8-7-9-12-26)41(34,50)20-19-40(42,49)23-39/h7-9,11-14,19-20,24,27-28,33,43,46,49-50H,10,15-18,21-23H2,1-6H3,(H,47,48) |
| InChIKey | OQOAZEATHIARMP-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.87 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|