C42H55NO7 — CID 162840114
6-[9,12-dihydroxy-2,6,6,15,19-pentamethyl-5,17-dioxo-8-(2-phenylethenyl)-14-pentacyclo[10.5.2.02,7.09,18.015,19]nonadeca-1(18),10-dienyl]-4-hydroxy-2-[2-(methylamino)ethyl]hept-2-enoic acid (PubChem CID 162840114) has the molecular formula C42H55NO7 and a molecular weight of 685.90 g/mol. Its IUPAC name is 6-[9,12-dihydroxy-2,6,6,15,19-pentamethyl-5,17-dioxo-8-(2-phenylethenyl)-14-pentacyclo[10.5.2.02,7.09,18.015,19]nonadeca-1(18),10-dienyl]-4-hydroxy-2-[2-(methylamino)ethyl]hept-2-enoic acid.
| Compound Name | 6-[9,12-dihydroxy-2,6,6,15,19-pentamethyl-5,17-dioxo-8-(2-phenylethenyl)-14-pentacyclo[10.5.2.02,7.09,18.015,19]nonadeca-1(18),10-dienyl]-4-hydroxy-2-[2-(methylamino)ethyl]hept-2-enoic acid |
|---|---|
| PubChem CID | 162840114 |
| Molecular Formula | C42H55NO7 |
| Molecular Weight | 685.90 g/mol |
| Exact Mass | 685.40 |
| IUPAC Name | 6-[9,12-dihydroxy-2,6,6,15,19-pentamethyl-5,17-dioxo-8-(2-phenylethenyl)-14-pentacyclo[10.5.2.02,7.09,18.015,19]nonadeca-1(18),10-dienyl]-4-hydroxy-2-[2-(methylamino)ethyl]hept-2-enoic acid |
| SMILES | CNCCC(=CC(O)CC(C)C1CC2(O)C=CC3(O)C4=C(C(=O)CC1(C)C42C)C1(C)CCC(=O)C(C)(C)C1C3C=Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C42H55NO7/c1-25(21-28(44)22-27(36(47)48)16-20-43-7)30-23-41(49)18-19-42(50)29(14-13-26-11-9-8-10-12-26)34-37(2,3)32(46)15-17-38(34,4)33-31(45)24-39(30,5)40(41,6)35(33)42/h8-14,18-19,22,25,28-30,34,43-44,49-50H,15-17,20-21,23-24H2,1-7H3,(H,47,48) |
| InChIKey | NSCOFBZHZRQVAM-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 144.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.90 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|