C43H54O8 — CID 163127238
5-[9,12-dihydroxy-2,6,6,21,22-pentamethyl-5,24-dioxo-8-(2-phenylethenyl)-15-hexacyclo[18.3.1.02,7.09,23.012,22.014,21]tetracosa-1(23),10-dienyl]-4-hydroxy-2-methyl-3-oxopentanoic acid (PubChem CID 163127238) has the molecular formula C43H54O8 and a molecular weight of 698.90 g/mol. Its IUPAC name is 5-[9,12-dihydroxy-2,6,6,21,22-pentamethyl-5,24-dioxo-8-(2-phenylethenyl)-15-hexacyclo[18.3.1.02,7.09,23.012,22.014,21]tetracosa-1(23),10-dienyl]-4-hydroxy-2-methyl-3-oxopentanoic acid.
| Compound Name | 5-[9,12-dihydroxy-2,6,6,21,22-pentamethyl-5,24-dioxo-8-(2-phenylethenyl)-15-hexacyclo[18.3.1.02,7.09,23.012,22.014,21]tetracosa-1(23),10-dienyl]-4-hydroxy-2-methyl-3-oxopentanoic acid |
|---|---|
| PubChem CID | 163127238 |
| Molecular Formula | C43H54O8 |
| Molecular Weight | 698.90 g/mol |
| Exact Mass | 698.38 |
| IUPAC Name | 5-[9,12-dihydroxy-2,6,6,21,22-pentamethyl-5,24-dioxo-8-(2-phenylethenyl)-15-hexacyclo[18.3.1.02,7.09,23.012,22.014,21]tetracosa-1(23),10-dienyl]-4-hydroxy-2-methyl-3-oxopentanoic acid |
| SMILES | CC(C(=O)O)C(=O)C(O)CC1CCCCC2C(=O)C3=C4C(O)(C=CC5(O)CC1C2(C)C45C)C(C=Cc1ccccc1)C1C(C)(C)C(=O)CCC31C |
| InChI | InChI=1S/C43H54O8/c1-24(37(48)49)33(46)30(44)22-26-14-10-11-15-27-34(47)32-36-41(6)40(27,5)29(26)23-42(41,50)20-21-43(36,51)28(17-16-25-12-8-7-9-13-25)35-38(2,3)31(45)18-19-39(32,35)4/h7-9,12-13,16-17,20-21,24,26-30,35,44,50-51H,10-11,14-15,18-19,22-23H2,1-6H3,(H,48,49) |
| InChIKey | DUGSJBTZVSBFOE-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.90 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|