C92H93NO9 — CID 162835705
CID 162835705 (PubChem CID 162835705) has the molecular formula C92H93NO9 and a molecular weight of 1356.75 g/mol.
| Compound Name | CID 162835705 |
|---|---|
| PubChem CID | 162835705 |
| Molecular Formula | C92H93NO9 |
| Molecular Weight | 1356.75 g/mol |
| Exact Mass | 1355.69 |
| IUPAC Name | — |
| SMILES | COc1cc([C@@H]2CC(=O)[C@H]3[C@@H]4C=CC56C#CC[C@@H]7N[C@]89CC[C@@]3(O)[C@H]([C@@H]7C#C[C@H]2Cc2ccccc2)[C@@]82c3cc(O)c(O)cc3[C@@H]3C[C@H]2[C@]27C[C@]38CCC[C@@H]8C=C2[C@@H]2C[C@@H](O)C(=CC2=C[C@H]7C9)[C@@]23CCCC[C@@H]2C2=C7C(=CC2)[C@@H]2CCC8(CCCC8)[C@]2(C[C@H]5O)c2c7c3cc4c26)c(CO)cc1O |
| InChI | InChI=1S/C92H93NO9/c1-102-75-40-58(50(45-94)34-73(75)98)57-37-74(99)80-53-20-28-85-24-10-15-69-56(17-16-48(57)31-47-11-3-2-4-12-47)83-91(80,101)30-29-87(93-69)43-52-32-49-33-67(70(95)38-59(49)65-35-51-13-9-25-86(51)46-89(52,65)76-42-64(86)61-39-71(96)72(97)41-66(61)92(76,83)87)88-26-6-5-14-62(88)54-18-19-55-63-21-27-84(22-7-8-23-84)90(63,44-77(85)100)82-79(78(54)55)68(88)36-60(53)81(82)85/h2-4,11-12,19-20,28,32-36,39-41,48,51-53,56-57,59,62-64,69-70,76-77,80,83,93-98,100-101H,5-9,13-15,18,21-23,25-27,29-31,37-38,42-46H2,1H3/t48-,51+,52-,53+,56+,57+,59+,62+,63-,64-,69-,70+,76-,77+,80+,83-,85?,86-,87-,88+,89-,90-,91-,92-/m0/s1 |
| InChIKey | MYUIPVRRFUXAMO-RPAHLMODSA-N |
| XLogP | 14.26 |
| TPSA | 179.94 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 102 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1356.75 |
| LogP ≤ 5 | 14.26 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|