C28H35NO3 — CID 162837809
16-benzyl-2,12-dihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,5,9-trien-18-one (PubChem CID 162837809) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is 16-benzyl-2,12-dihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,5,9-trien-18-one.
| Compound Name | 16-benzyl-2,12-dihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,5,9-trien-18-one |
|---|---|
| PubChem CID | 162837809 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 16-benzyl-2,12-dihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadeca-3,5,9-trien-18-one |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23C(O)C=CC(C)=CC(C)CC=CC3C1O |
| InChI | InChI=1S/C28H35NO3/c1-17-9-8-12-22-26(31)20(4)19(3)25-23(16-21-10-6-5-7-11-21)29-27(32)28(22,25)24(30)14-13-18(2)15-17/h5-8,10-15,17,19,22-26,30-31H,4,9,16H2,1-3H3,(H,29,32) |
| InChIKey | CZABEFNJKKLRKT-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|