C28H37NO5 — CID 162926447
(1R,4R,5S,7S,11R,12S,14R,15R,16S)-16-benzyl-4,5,12-trihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadec-9-ene-2,18-dione (PubChem CID 162926447) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is (1R,4R,5S,7S,11R,12S,14R,15R,16S)-16-benzyl-4,5,12-trihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadec-9-ene-2,18-dione.
| Compound Name | (1R,4R,5S,7S,11R,12S,14R,15R,16S)-16-benzyl-4,5,12-trihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadec-9-ene-2,18-dione |
|---|---|
| PubChem CID | 162926447 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | (1R,4R,5S,7S,11R,12S,14R,15R,16S)-16-benzyl-4,5,12-trihydroxy-5,7,14-trimethyl-13-methylidene-17-azatricyclo[9.7.0.01,15]octadec-9-ene-2,18-dione |
| SMILES | C=C1[C@@H](O)[C@@H]2C=CC[C@H](C)C[C@](C)(O)[C@H](O)CC(=O)[C@]23C(=O)N[C@@H](Cc2ccccc2)[C@@H]3[C@H]1C |
| InChI | InChI=1S/C28H37NO5/c1-16-9-8-12-20-25(32)18(3)17(2)24-21(13-19-10-6-5-7-11-19)29-26(33)28(20,24)23(31)14-22(30)27(4,34)15-16/h5-8,10-12,16-17,20-22,24-25,30,32,34H,3,9,13-15H2,1-2,4H3,(H,29,33)/t16-,17-,20-,21-,22+,24-,25+,27-,28+/m0/s1 |
| InChIKey | LKQNJXBAEOWNOG-ZITWQCODSA-N |
| XLogP | 2.57 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|