C28H35NO6 — CID 6440595
(10E)-17-benzyl-3,6,13-trihydroxy-6,8,15-trimethyl-14-methylidene-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadec-10-ene-7,19-dione (PubChem CID 6440595) has the molecular formula C28H35NO6 and a molecular weight of 481.59 g/mol. Its IUPAC name is (10E)-17-benzyl-3,6,13-trihydroxy-6,8,15-trimethyl-14-methylidene-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadec-10-ene-7,19-dione.
| Compound Name | (10E)-17-benzyl-3,6,13-trihydroxy-6,8,15-trimethyl-14-methylidene-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadec-10-ene-7,19-dione |
|---|---|
| PubChem CID | 6440595 |
| Molecular Formula | C28H35NO6 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.25 |
| IUPAC Name | (10E)-17-benzyl-3,6,13-trihydroxy-6,8,15-trimethyl-14-methylidene-4-oxa-18-azatetracyclo[10.7.0.01,16.03,5]nonadec-10-ene-7,19-dione |
| SMILES | C=C1C(C)C2C(Cc3ccccc3)NC(=O)C23CC2(O)OC2C(C)(O)C(=O)C(C)C/C=C/C3C1O |
| InChI | InChI=1S/C28H35NO6/c1-15-9-8-12-19-22(30)17(3)16(2)21-20(13-18-10-6-5-7-11-18)29-25(32)27(19,21)14-28(34)24(35-28)26(4,33)23(15)31/h5-8,10-12,15-16,19-22,24,30,33-34H,3,9,13-14H2,1-2,4H3,(H,29,32)/b12-8+ |
| InChIKey | KHXIYTOCQZQSDM-XYOKQWHBSA-N |
| XLogP | 1.91 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|