C10H16O5 — CID 162842252
(3S)-2,2-dimethyl-3-(3-oxobutyl)butanedioic acid (PubChem CID 162842252) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (3S)-2,2-dimethyl-3-(3-oxobutyl)butanedioic acid.
| Compound Name | (3S)-2,2-dimethyl-3-(3-oxobutyl)butanedioic acid |
|---|---|
| PubChem CID | 162842252 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (3S)-2,2-dimethyl-3-(3-oxobutyl)butanedioic acid |
| SMILES | CC(=O)CC[C@H](C(=O)O)C(C)(C)C(=O)O |
| InChI | InChI=1S/C10H16O5/c1-6(11)4-5-7(8(12)13)10(2,3)9(14)15/h7H,4-5H2,1-3H3,(H,12,13)(H,14,15)/t7-/m1/s1 |
| InChIKey | ANBPUXRGFBFXHA-SSDOTTSWSA-N |
| XLogP | 1.17 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |