C10H21N3O3 — CID 87966161
2,2,3-tris(methylamino)-6-oxoheptanoic acid (PubChem CID 87966161) has the molecular formula C10H21N3O3 and a molecular weight of 231.30 g/mol. Its IUPAC name is 2,2,3-tris(methylamino)-6-oxoheptanoic acid.
| Compound Name | 2,2,3-tris(methylamino)-6-oxoheptanoic acid |
|---|---|
| PubChem CID | 87966161 |
| Molecular Formula | C10H21N3O3 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.16 |
| IUPAC Name | 2,2,3-tris(methylamino)-6-oxoheptanoic acid |
| SMILES | CNC(CCC(C)=O)C(NC)(NC)C(=O)O |
| InChI | InChI=1S/C10H21N3O3/c1-7(14)5-6-8(11-2)10(12-3,13-4)9(15)16/h8,11-13H,5-6H2,1-4H3,(H,15,16) |
| InChIKey | XVXHVZWFBPMKAM-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|