C18H26O3 — CID 162842844
(1S,2S,3Z,6Z,14R,16S,17R)-17-ethyl-13,18-dioxatricyclo[12.4.0.02,16]octadeca-3,6-dien-12-one (PubChem CID 162842844) has the molecular formula C18H26O3 and a molecular weight of 290.40 g/mol. Its IUPAC name is (1S,2S,3Z,6Z,14R,16S,17R)-17-ethyl-13,18-dioxatricyclo[12.4.0.02,16]octadeca-3,6-dien-12-one.
| Compound Name | (1S,2S,3Z,6Z,14R,16S,17R)-17-ethyl-13,18-dioxatricyclo[12.4.0.02,16]octadeca-3,6-dien-12-one |
|---|---|
| PubChem CID | 162842844 |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (1S,2S,3Z,6Z,14R,16S,17R)-17-ethyl-13,18-dioxatricyclo[12.4.0.02,16]octadeca-3,6-dien-12-one |
| SMILES | CC[C@H]1O[C@H]2[C@H]3/C=C\C/C=C\CCCCC(=O)O[C@@H]2C[C@@H]31 |
| InChI | InChI=1S/C18H26O3/c1-2-15-14-12-16-18(21-15)13(14)10-8-6-4-3-5-7-9-11-17(19)20-16/h3-4,8,10,13-16,18H,2,5-7,9,11-12H2,1H3/b4-3-,10-8-/t13-,14-,15+,16+,18-/m0/s1 |
| InChIKey | QSWIYENAXAFSAX-JFGONRLSSA-N |
| XLogP | 3.79 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|