C21H38O9 — CID 162845550
(7R)-13-oxo-7-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxytetradecanoic acid (PubChem CID 162845550) has the molecular formula C21H38O9 and a molecular weight of 434.53 g/mol. Its IUPAC name is (7R)-13-oxo-7-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxytetradecanoic acid.
| Compound Name | (7R)-13-oxo-7-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxytetradecanoic acid |
|---|---|
| PubChem CID | 162845550 |
| Molecular Formula | C21H38O9 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.25 |
| IUPAC Name | (7R)-13-oxo-7-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(methoxymethyl)oxan-2-yl]oxytetradecanoic acid |
| SMILES | COC[C@@H]1O[C@@H](O[C@H](CCCCCC(C)=O)CCCCCC(=O)O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C21H38O9/c1-14(22)9-5-3-6-10-15(11-7-4-8-12-17(23)24)29-21-20(27)19(26)18(25)16(30-21)13-28-2/h15-16,18-21,25-27H,3-13H2,1-2H3,(H,23,24)/t15-,16+,18+,19-,20+,21-/m1/s1 |
| InChIKey | IBDPEULNUMJDEE-KGNSMVPNSA-N |
| XLogP | 1.40 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|