C18H28O3 — CID 162849692
(7S,9Z,12Z)-7-hydroxyoctadeca-9,12-dien-5-ynoic acid (PubChem CID 162849692) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (7S,9Z,12Z)-7-hydroxyoctadeca-9,12-dien-5-ynoic acid.
| Compound Name | (7S,9Z,12Z)-7-hydroxyoctadeca-9,12-dien-5-ynoic acid |
|---|---|
| PubChem CID | 162849692 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (7S,9Z,12Z)-7-hydroxyoctadeca-9,12-dien-5-ynoic acid |
| SMILES | CCCCC/C=C\C/C=C\C[C@H](O)C#CCCCC(=O)O |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-5-6-7-8-9-11-14-17(19)15-12-10-13-16-18(20)21/h6-7,9,11,17,19H,2-5,8,10,13-14,16H2,1H3,(H,20,21)/b7-6-,11-9-/t17-/m0/s1 |
| InChIKey | NSMPAJLGSQXBPP-DHEMNJJNSA-N |
| XLogP | 4.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|