C22H30O8 — CID 162850021
[(1R,2R,4S,5R,6R,8R,11R,12S)-11-(acetyloxymethyl)-2-hydroxy-2,6-dimethyl-10-oxo-9,14-dioxatetracyclo[9.2.1.01,5.08,12]tetradecan-4-yl] (E)-2-methylbut-2-enoate (PubChem CID 162850021) has the molecular formula C22H30O8 and a molecular weight of 422.47 g/mol. Its IUPAC name is [(1R,2R,4S,5R,6R,8R,11R,12S)-11-(acetyloxymethyl)-2-hydroxy-2,6-dimethyl-10-oxo-9,14-dioxatetracyclo[9.2.1.01,5.08,12]tetradecan-4-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2R,4S,5R,6R,8R,11R,12S)-11-(acetyloxymethyl)-2-hydroxy-2,6-dimethyl-10-oxo-9,14-dioxatetracyclo[9.2.1.01,5.08,12]tetradecan-4-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162850021 |
| Molecular Formula | C22H30O8 |
| Molecular Weight | 422.47 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | [(1R,2R,4S,5R,6R,8R,11R,12S)-11-(acetyloxymethyl)-2-hydroxy-2,6-dimethyl-10-oxo-9,14-dioxatetracyclo[9.2.1.01,5.08,12]tetradecan-4-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@H]1C[C@@](C)(O)[C@@]23C[C@H]4[C@@H](C[C@@H](C)[C@H]12)OC(=O)[C@@]4(COC(C)=O)O3 |
| InChI | InChI=1S/C22H30O8/c1-6-11(2)18(24)28-16-9-20(5,26)22-8-14-15(7-12(3)17(16)22)29-19(25)21(14,30-22)10-27-13(4)23/h6,12,14-17,26H,7-10H2,1-5H3/b11-6+/t12-,14+,15-,16+,17-,20-,21+,22-/m1/s1 |
| InChIKey | ZXNPAOQPILEQMK-QOOYOOTGSA-N |
| XLogP | 1.68 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.47 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|