C29H32N2O7 — CID 162851068
[(3R)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2R,3R)-3-[[(1R)-1-amino-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]-2-methyloxirane-2-carboxylate (PubChem CID 162851068) has the molecular formula C29H32N2O7 and a molecular weight of 520.58 g/mol. Its IUPAC name is [(3R)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2R,3R)-3-[[(1R)-1-amino-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]-2-methyloxirane-2-carboxylate.
| Compound Name | [(3R)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2R,3R)-3-[[(1R)-1-amino-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]-2-methyloxirane-2-carboxylate |
|---|---|
| PubChem CID | 162851068 |
| Molecular Formula | C29H32N2O7 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | [(3R)-5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl] (2R,3R)-3-[[(1R)-1-amino-1,2,3,4-tetrahydroisoquinolin-5-yl]methyl]-2-methyloxirane-2-carboxylate |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)[C@H](OC(=O)[C@]1(C)O[C@@H]1Cc1cccc2c1CCN[C@H]2N)C3 |
| InChI | InChI=1S/C29H32N2O7/c1-14-10-19(32)24-21(35-14)13-20-18(25(24)33)12-22(28(2,3)37-20)36-27(34)29(4)23(38-29)11-15-6-5-7-17-16(15)8-9-31-26(17)30/h5-7,10,13,22-23,26,31,33H,8-9,11-12,30H2,1-4H3/t22-,23-,26-,29-/m1/s1 |
| InChIKey | AGCCQBFXXZCJJI-GHGYURFVSA-N |
| XLogP | 2.94 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|