C28H33N3O7 — CID 162795696
(5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-amino-4-pyridinyl)ethyl]-2-[2-(methylamino)ethyl]oxirane-2-carboxylate (PubChem CID 162795696) has the molecular formula C28H33N3O7 and a molecular weight of 523.59 g/mol. Its IUPAC name is (5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-amino-4-pyridinyl)ethyl]-2-[2-(methylamino)ethyl]oxirane-2-carboxylate.
| Compound Name | (5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-amino-4-pyridinyl)ethyl]-2-[2-(methylamino)ethyl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 162795696 |
| Molecular Formula | C28H33N3O7 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.23 |
| IUPAC Name | (5-hydroxy-2,2,8-trimethyl-6-oxo-3,4-dihydropyrano[3,2-g]chromen-3-yl) 3-[2-(2-amino-4-pyridinyl)ethyl]-2-[2-(methylamino)ethyl]oxirane-2-carboxylate |
| SMILES | CNCCC1(C(=O)OC2Cc3c(cc4oc(C)cc(=O)c4c3O)OC2(C)C)OC1CCc1ccnc(N)c1 |
| InChI | InChI=1S/C28H33N3O7/c1-15-11-18(32)24-20(35-15)14-19-17(25(24)33)13-22(27(2,3)37-19)36-26(34)28(8-10-30-4)21(38-28)6-5-16-7-9-31-23(29)12-16/h7,9,11-12,14,21-22,30,33H,5-6,8,10,13H2,1-4H3,(H2,29,31) |
| InChIKey | TVBMXOXHBAWGEE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 149.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|