C28H30N2O7 — CID 163018784
(2R,3'R,6R,9R)-3'-[2-(2-amino-4-pyridinyl)ethyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione (PubChem CID 163018784) has the molecular formula C28H30N2O7 and a molecular weight of 506.56 g/mol. Its IUPAC name is (2R,3'R,6R,9R)-3'-[2-(2-amino-4-pyridinyl)ethyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione.
| Compound Name | (2R,3'R,6R,9R)-3'-[2-(2-amino-4-pyridinyl)ethyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione |
|---|---|
| PubChem CID | 163018784 |
| Molecular Formula | C28H30N2O7 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | (2R,3'R,6R,9R)-3'-[2-(2-amino-4-pyridinyl)ethyl]-20-hydroxy-10,10,16-trimethylspiro[8,11,15-trioxatetracyclo[10.8.0.02,9.014,19]icosa-1(12),13,16,19-tetraene-6,2'-oxirane]-7,18-dione |
| SMILES | Cc1cc(=O)c2c(O)c3c(cc2o1)OC(C)(C)[C@@H]1OC(=O)[C@]2(CCC[C@H]31)O[C@@H]2CCc1ccnc(N)c1 |
| InChI | InChI=1S/C28H30N2O7/c1-14-11-17(31)23-18(34-14)13-19-22(24(23)32)16-5-4-9-28(26(33)35-25(16)27(2,3)36-19)20(37-28)7-6-15-8-10-30-21(29)12-15/h8,10-13,16,20,25,32H,4-7,9H2,1-3H3,(H2,29,30)/t16-,20-,25-,28-/m1/s1 |
| InChIKey | IVGIVAGZDDUVAX-JXUVZLQTSA-N |
| XLogP | 3.90 |
| TPSA | 137.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|